Effect of doping concentration and sintering temperature on structure and photoluminescence properties of blue/red emitting bi-phase Eu3+/Eu2+-doped Sr5(PO4)3Cl/Sr3(PO4)2phosphors
Lưu vào:
| Tác giả chính: | , , |
|---|---|
| Đồng tác giả: | |
| Nhà xuất bản: |
2020
|
| Truy cập trực tuyến: | https://dlib.phenikaa-uni.edu.vn/handle/PNK/300 https://doi.org/10.1088/2053-1591/aacf3b |
| Từ khóa: |
Thêm từ khóa
Không có từ khóa, Hãy là người đầu tiên đánh dấu biểu ghi này!
|
